C25H25N4O2+ — CID 8821820
[4-[[(1,3-dioxo-2-pyridin-2-yl-4H-isoquinolin-4-yl)methylideneamino]methyl]phenyl]methyl-dimethylazanium (PubChem CID 8821820) has the molecular formula C25H25N4O2+ and a molecular weight of 413.50 g/mol. Its IUPAC name is [4-[[(1,3-dioxo-2-pyridin-2-yl-4H-isoquinolin-4-yl)methylideneamino]methyl]phenyl]methyl-dimethylazanium.
| Compound Name | [4-[[(1,3-dioxo-2-pyridin-2-yl-4H-isoquinolin-4-yl)methylideneamino]methyl]phenyl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 8821820 |
| Molecular Formula | C25H25N4O2+ |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [4-[[(1,3-dioxo-2-pyridin-2-yl-4H-isoquinolin-4-yl)methylideneamino]methyl]phenyl]methyl-dimethylazanium |
| SMILES | C[NH+](C)Cc1ccc(C/N=C/C2C(=O)N(c3ccccn3)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H24N4O2/c1-28(2)17-19-12-10-18(11-13-19)15-26-16-22-20-7-3-4-8-21(20)24(30)29(25(22)31)23-9-5-6-14-27-23/h3-14,16,22H,15,17H2,1-2H3/p+1/b26-16+ |
| InChIKey | DOLBBWGTMFHHLN-WGOQTCKBSA-O |
| XLogP | 2.27 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|