C22H16ClN3O2 — CID 7481654
(4R)-2-(2-chlorophenyl)-4-(pyridin-4-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione (PubChem CID 7481654) has the molecular formula C22H16ClN3O2 and a molecular weight of 389.84 g/mol. Its IUPAC name is (4R)-2-(2-chlorophenyl)-4-(pyridin-4-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione.
| Compound Name | (4R)-2-(2-chlorophenyl)-4-(pyridin-4-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7481654 |
| Molecular Formula | C22H16ClN3O2 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (4R)-2-(2-chlorophenyl)-4-(pyridin-4-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione |
| SMILES | O=C1c2ccccc2[C@H](/C=N/Cc2ccncc2)C(=O)N1c1ccccc1Cl |
| InChI | InChI=1S/C22H16ClN3O2/c23-19-7-3-4-8-20(19)26-21(27)17-6-2-1-5-16(17)18(22(26)28)14-25-13-15-9-11-24-12-10-15/h1-12,14,18H,13H2/b25-14+/t18-/m0/s1 |
| InChIKey | GAOHENFNGLUJMJ-MJDKSPQASA-N |
| XLogP | 4.28 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|