C25H22N2O2 — CID 7392601
(4R)-4-(benzyliminomethyl)-2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione (PubChem CID 7392601) has the molecular formula C25H22N2O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is (4R)-4-(benzyliminomethyl)-2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione.
| Compound Name | (4R)-4-(benzyliminomethyl)-2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7392601 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (4R)-4-(benzyliminomethyl)-2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3ccccc3[C@H](/C=N/Cc3ccccc3)C2=O)cc1C |
| InChI | InChI=1S/C25H22N2O2/c1-17-12-13-20(14-18(17)2)27-24(28)22-11-7-6-10-21(22)23(25(27)29)16-26-15-19-8-4-3-5-9-19/h3-14,16,23H,15H2,1-2H3/b26-16+/t23-/m0/s1 |
| InChIKey | HSSYTJJRLWZMPP-LRULAXNGSA-N |
| XLogP | 4.85 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|