C25H28N2O3 — CID 8822029
(4R)-4-[3-(cyclopropylmethoxy)propyliminomethyl]-2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione (PubChem CID 8822029) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is (4R)-4-[3-(cyclopropylmethoxy)propyliminomethyl]-2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione.
| Compound Name | (4R)-4-[3-(cyclopropylmethoxy)propyliminomethyl]-2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 8822029 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (4R)-4-[3-(cyclopropylmethoxy)propyliminomethyl]-2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3ccccc3[C@H](/C=N/CCCOCC3CC3)C2=O)cc1C |
| InChI | InChI=1S/C25H28N2O3/c1-17-8-11-20(14-18(17)2)27-24(28)22-7-4-3-6-21(22)23(25(27)29)15-26-12-5-13-30-16-19-9-10-19/h3-4,6-8,11,14-15,19,23H,5,9-10,12-13,16H2,1-2H3/b26-15+/t23-/m0/s1 |
| InChIKey | PAXDWDAOSFLRFM-XQQQEEOESA-N |
| XLogP | 4.46 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|