C22H24N2O3 — CID 9312323
(4R)-2-(3,4-dimethylphenyl)-4-[[(2S)-1-methoxypropan-2-yl]iminomethyl]-4H-isoquinoline-1,3-dione (PubChem CID 9312323) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is (4R)-2-(3,4-dimethylphenyl)-4-[[(2S)-1-methoxypropan-2-yl]iminomethyl]-4H-isoquinoline-1,3-dione.
| Compound Name | (4R)-2-(3,4-dimethylphenyl)-4-[[(2S)-1-methoxypropan-2-yl]iminomethyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 9312323 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (4R)-2-(3,4-dimethylphenyl)-4-[[(2S)-1-methoxypropan-2-yl]iminomethyl]-4H-isoquinoline-1,3-dione |
| SMILES | COC[C@H](C)/N=C/[C@@H]1C(=O)N(c2ccc(C)c(C)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H24N2O3/c1-14-9-10-17(11-15(14)2)24-21(25)19-8-6-5-7-18(19)20(22(24)26)12-23-16(3)13-27-4/h5-12,16,20H,13H2,1-4H3/b23-12+/t16-,20-/m0/s1 |
| InChIKey | LEOGWLXJDYMIFS-PQKFSCNMSA-N |
| XLogP | 3.68 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|