C24H22N2O5 — CID 8821742
2-(3,4-dimethoxyphenyl)-4-[[(1R)-1-(furan-2-yl)ethyl]iminomethyl]-4H-isoquinoline-1,3-dione (PubChem CID 8821742) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-[[(1R)-1-(furan-2-yl)ethyl]iminomethyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-[[(1R)-1-(furan-2-yl)ethyl]iminomethyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 8821742 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-[[(1R)-1-(furan-2-yl)ethyl]iminomethyl]-4H-isoquinoline-1,3-dione |
| SMILES | COc1ccc(N2C(=O)c3ccccc3C(/C=N/[C@H](C)c3ccco3)C2=O)cc1OC |
| InChI | InChI=1S/C24H22N2O5/c1-15(20-9-6-12-31-20)25-14-19-17-7-4-5-8-18(17)23(27)26(24(19)28)16-10-11-21(29-2)22(13-16)30-3/h4-15,19H,1-3H3/b25-14+/t15-,19?/m1/s1 |
| InChIKey | KZMYTSCTLFCIIW-KYLRAIOASA-N |
| XLogP | 4.40 |
| TPSA | 81.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|