C23H27N3O4 — CID 7421853
2-(3,4-dimethoxyphenyl)-4-[3-(dimethylamino)propyliminomethyl]-4H-isoquinoline-1,3-dione (PubChem CID 7421853) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-[3-(dimethylamino)propyliminomethyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-[3-(dimethylamino)propyliminomethyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7421853 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-[3-(dimethylamino)propyliminomethyl]-4H-isoquinoline-1,3-dione |
| SMILES | COc1ccc(N2C(=O)c3ccccc3C(/C=N/CCCN(C)C)C2=O)cc1OC |
| InChI | InChI=1S/C23H27N3O4/c1-25(2)13-7-12-24-15-19-17-8-5-6-9-18(17)22(27)26(23(19)28)16-10-11-20(29-3)21(14-16)30-4/h5-6,8-11,14-15,19H,7,12-13H2,1-4H3/b24-15+ |
| InChIKey | SKSPUFFKDKCERJ-BUVRLJJBSA-N |
| XLogP | 3.00 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|