C22H24N2O5 — CID 9312148
2-(3,4-dimethoxyphenyl)-4-(3-methoxypropyliminomethyl)-4H-isoquinoline-1,3-dione (PubChem CID 9312148) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-(3-methoxypropyliminomethyl)-4H-isoquinoline-1,3-dione.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-(3-methoxypropyliminomethyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 9312148 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-(3-methoxypropyliminomethyl)-4H-isoquinoline-1,3-dione |
| SMILES | COCCC/N=C/C1C(=O)N(c2ccc(OC)c(OC)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H24N2O5/c1-27-12-6-11-23-14-18-16-7-4-5-8-17(16)21(25)24(22(18)26)15-9-10-19(28-2)20(13-15)29-3/h4-5,7-10,13-14,18H,6,11-12H2,1-3H3/b23-14+ |
| InChIKey | GWOJOADQDNXGQQ-OEAKJJBVSA-N |
| XLogP | 3.08 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|