C21H23ClN3O2+ — CID 9312162
3-[[2-(3-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]propyl-dimethylazanium (PubChem CID 9312162) has the molecular formula C21H23ClN3O2+ and a molecular weight of 384.89 g/mol. Its IUPAC name is 3-[[2-(3-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]propyl-dimethylazanium.
| Compound Name | 3-[[2-(3-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 9312162 |
| Molecular Formula | C21H23ClN3O2+ |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 3-[[2-(3-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCC/N=C/C1C(=O)N(c2cccc(Cl)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H22ClN3O2/c1-24(2)12-6-11-23-14-19-17-9-3-4-10-18(17)20(26)25(21(19)27)16-8-5-7-15(22)13-16/h3-5,7-10,13-14,19H,6,11-12H2,1-2H3/p+1/b23-14+ |
| InChIKey | KFHALNGAAULXTH-OEAKJJBVSA-O |
| XLogP | 2.22 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|