C18H14Cl2N2O3 — CID 7057848
(4S)-2-(2,3-dichlorophenyl)-4-(2-hydroxyethyliminomethyl)-4H-isoquinoline-1,3-dione (PubChem CID 7057848) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is (4S)-2-(2,3-dichlorophenyl)-4-(2-hydroxyethyliminomethyl)-4H-isoquinoline-1,3-dione.
| Compound Name | (4S)-2-(2,3-dichlorophenyl)-4-(2-hydroxyethyliminomethyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7057848 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | (4S)-2-(2,3-dichlorophenyl)-4-(2-hydroxyethyliminomethyl)-4H-isoquinoline-1,3-dione |
| SMILES | O=C1c2ccccc2[C@@H](/C=N/CCO)C(=O)N1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H14Cl2N2O3/c19-14-6-3-7-15(16(14)20)22-17(24)12-5-2-1-4-11(12)13(18(22)25)10-21-8-9-23/h1-7,10,13,23H,8-9H2/b21-10+/t13-/m1/s1 |
| InChIKey | TXTRNMMFQAOYIQ-WVISFHDSSA-N |
| XLogP | 3.33 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|