C22H18ClN3O2 — CID 9312477
(2R)-2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]-2-cyclopropylpropanenitrile (PubChem CID 9312477) has the molecular formula C22H18ClN3O2 and a molecular weight of 391.86 g/mol. Its IUPAC name is (2R)-2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]-2-cyclopropylpropanenitrile.
| Compound Name | (2R)-2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]-2-cyclopropylpropanenitrile |
|---|---|
| PubChem CID | 9312477 |
| Molecular Formula | C22H18ClN3O2 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (2R)-2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]-2-cyclopropylpropanenitrile |
| SMILES | C[C@@](C#N)(/N=C/C1C(=O)N(c2ccccc2Cl)C(=O)c2ccccc21)C1CC1 |
| InChI | InChI=1S/C22H18ClN3O2/c1-22(13-24,14-10-11-14)25-12-17-15-6-2-3-7-16(15)20(27)26(21(17)28)19-9-5-4-8-18(19)23/h2-9,12,14,17H,10-11H2,1H3/b25-12+/t17?,22-/m0/s1 |
| InChIKey | BKEXUGXCADJVRS-SGHWAMJYSA-N |
| XLogP | 4.37 |
| TPSA | 73.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|