C20H21ClN3O2+ — CID 9312174
2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]ethyl-dimethylazanium (PubChem CID 9312174) has the molecular formula C20H21ClN3O2+ and a molecular weight of 370.86 g/mol. Its IUPAC name is 2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]ethyl-dimethylazanium.
| Compound Name | 2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 9312174 |
| Molecular Formula | C20H21ClN3O2+ |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CC/N=C/C1C(=O)N(c2ccccc2Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H20ClN3O2/c1-23(2)12-11-22-13-16-14-7-3-4-8-15(14)19(25)24(20(16)26)18-10-6-5-9-17(18)21/h3-10,13,16H,11-12H2,1-2H3/p+1/b22-13+ |
| InChIKey | ZFUJKJVBFSKVSU-LPYMAVHISA-O |
| XLogP | 1.83 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|