C20H17ClN2O4 — CID 8811905
methyl (2S)-2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]propanoate (PubChem CID 8811905) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]propanoate.
| Compound Name | methyl (2S)-2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]propanoate |
|---|---|
| PubChem CID | 8811905 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | methyl (2S)-2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]propanoate |
| SMILES | COC(=O)[C@H](C)/N=C/C1C(=O)N(c2ccccc2Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H17ClN2O4/c1-12(20(26)27-2)22-11-15-13-7-3-4-8-14(13)18(24)23(19(15)25)17-10-6-5-9-16(17)21/h3-12,15H,1-2H3/b22-11+/t12-,15?/m0/s1 |
| InChIKey | IOGCMFLNRJFPIB-UUFAFNISSA-N |
| XLogP | 3.24 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|