C23H21N3O6 — CID 101042517
methyl 2-[[(2R,3R)-3-(1,3-dioxoisoindol-2-yl)-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]methylideneamino]propanoate (PubChem CID 101042517) has the molecular formula C23H21N3O6 and a molecular weight of 435.44 g/mol. Its IUPAC name is methyl 2-[[(2R,3R)-3-(1,3-dioxoisoindol-2-yl)-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]methylideneamino]propanoate.
| Compound Name | methyl 2-[[(2R,3R)-3-(1,3-dioxoisoindol-2-yl)-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]methylideneamino]propanoate |
|---|---|
| PubChem CID | 101042517 |
| Molecular Formula | C23H21N3O6 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | methyl 2-[[(2R,3R)-3-(1,3-dioxoisoindol-2-yl)-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]methylideneamino]propanoate |
| SMILES | COC(=O)C(C)/N=C/[C@H]1[C@@H](N2C(=O)c3ccccc3C2=O)C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H21N3O6/c1-13(23(30)32-3)24-12-18-19(22(29)25(18)14-8-10-15(31-2)11-9-14)26-20(27)16-6-4-5-7-17(16)21(26)28/h4-13,18-19H,1-3H3/b24-12+/t13?,18-,19+/m0/s1 |
| InChIKey | ABIPOCLMKJLMPI-KNGQLHATSA-N |
| XLogP | 1.71 |
| TPSA | 105.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|