C22H20ClN3O2 — CID 9312571
(2S)-2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]-2,3-dimethylbutanenitrile (PubChem CID 9312571) has the molecular formula C22H20ClN3O2 and a molecular weight of 393.87 g/mol. Its IUPAC name is (2S)-2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]-2,3-dimethylbutanenitrile.
| Compound Name | (2S)-2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]-2,3-dimethylbutanenitrile |
|---|---|
| PubChem CID | 9312571 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | (2S)-2-[[2-(2-chlorophenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]-2,3-dimethylbutanenitrile |
| SMILES | CC(C)[C@@](C)(C#N)/N=C/C1C(=O)N(c2ccccc2Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H20ClN3O2/c1-14(2)22(3,13-24)25-12-17-15-8-4-5-9-16(15)20(27)26(21(17)28)19-11-7-6-10-18(19)23/h4-12,14,17H,1-3H3/b25-12+/t17?,22-/m1/s1 |
| InChIKey | IAUADMUDTIYDRB-TYCNIVKBSA-N |
| XLogP | 4.62 |
| TPSA | 73.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|