C24H27ClN3O2+ — CID 9125785
2-(3-chloro-2-methylphenyl)-4-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyliminomethyl]-4H-isoquinoline-1,3-dione (PubChem CID 9125785) has the molecular formula C24H27ClN3O2+ and a molecular weight of 424.95 g/mol. Its IUPAC name is 2-(3-chloro-2-methylphenyl)-4-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyliminomethyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 2-(3-chloro-2-methylphenyl)-4-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyliminomethyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 9125785 |
| Molecular Formula | C24H27ClN3O2+ |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-(3-chloro-2-methylphenyl)-4-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyliminomethyl]-4H-isoquinoline-1,3-dione |
| SMILES | CC[NH+]1CCC[C@@H]1C/N=C/C1C(=O)N(c2cccc(Cl)c2C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H26ClN3O2/c1-3-27-13-7-8-17(27)14-26-15-20-18-9-4-5-10-19(18)23(29)28(24(20)30)22-12-6-11-21(25)16(22)2/h4-6,9-12,15,17,20H,3,7-8,13-14H2,1-2H3/p+1/b26-15+/t17-,20?/m1/s1 |
| InChIKey | HBOSHHJSIKZHJK-NIFSQQAMSA-O |
| XLogP | 3.06 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|