C24H29N4O2+ — CID 8821664
4-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyliminomethyl]-2-pyridin-2-yl-4H-isoquinoline-1,3-dione (PubChem CID 8821664) has the molecular formula C24H29N4O2+ and a molecular weight of 405.52 g/mol. Its IUPAC name is 4-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyliminomethyl]-2-pyridin-2-yl-4H-isoquinoline-1,3-dione.
| Compound Name | 4-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyliminomethyl]-2-pyridin-2-yl-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 8821664 |
| Molecular Formula | C24H29N4O2+ |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 4-[3-[(2S)-2-methylpiperidin-1-ium-1-yl]propyliminomethyl]-2-pyridin-2-yl-4H-isoquinoline-1,3-dione |
| SMILES | C[C@H]1CCCC[NH+]1CCC/N=C/C1C(=O)N(c2ccccn2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H28N4O2/c1-18-9-5-7-15-27(18)16-8-13-25-17-21-19-10-2-3-11-20(19)23(29)28(24(21)30)22-12-4-6-14-26-22/h2-4,6,10-12,14,17-18,21H,5,7-9,13,15-16H2,1H3/p+1/b25-17+/t18-,21?/m0/s1 |
| InChIKey | FETVDBOXRCQZCT-RPLNXATPSA-O |
| XLogP | 2.27 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|