C22H20N4O2 — CID 9312491
1-[[(4S)-1,3-dioxo-2-pyridin-2-yl-4H-isoquinolin-4-yl]methylideneamino]cyclohexane-1-carbonitrile (PubChem CID 9312491) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-[[(4S)-1,3-dioxo-2-pyridin-2-yl-4H-isoquinolin-4-yl]methylideneamino]cyclohexane-1-carbonitrile.
| Compound Name | 1-[[(4S)-1,3-dioxo-2-pyridin-2-yl-4H-isoquinolin-4-yl]methylideneamino]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 9312491 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-[[(4S)-1,3-dioxo-2-pyridin-2-yl-4H-isoquinolin-4-yl]methylideneamino]cyclohexane-1-carbonitrile |
| SMILES | N#CC1(/N=C/[C@H]2C(=O)N(c3ccccn3)C(=O)c3ccccc32)CCCCC1 |
| InChI | InChI=1S/C22H20N4O2/c23-15-22(11-5-1-6-12-22)25-14-18-16-8-2-3-9-17(16)20(27)26(21(18)28)19-10-4-7-13-24-19/h2-4,7-10,13-14,18H,1,5-6,11-12H2/b25-14+/t18-/m1/s1 |
| InChIKey | QJDFUAHAJPTQKC-VBYICHLGSA-N |
| XLogP | 3.65 |
| TPSA | 86.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|