C22H16N4O4 — CID 7698512
(4S)-2-(2-nitrophenyl)-4-(pyridin-2-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione (PubChem CID 7698512) has the molecular formula C22H16N4O4 and a molecular weight of 400.39 g/mol. Its IUPAC name is (4S)-2-(2-nitrophenyl)-4-(pyridin-2-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione.
| Compound Name | (4S)-2-(2-nitrophenyl)-4-(pyridin-2-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7698512 |
| Molecular Formula | C22H16N4O4 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (4S)-2-(2-nitrophenyl)-4-(pyridin-2-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione |
| SMILES | O=C1c2ccccc2[C@@H](/C=N/Cc2ccccn2)C(=O)N1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16N4O4/c27-21-17-9-2-1-8-16(17)18(14-23-13-15-7-5-6-12-24-15)22(28)25(21)19-10-3-4-11-20(19)26(29)30/h1-12,14,18H,13H2/b23-14+/t18-/m1/s1 |
| InChIKey | LPPBONRPTZXCQP-UEIZDATPSA-N |
| XLogP | 3.53 |
| TPSA | 105.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|