C24H21N3O2 — CID 9312120
(4R)-2-(3,4-dimethylphenyl)-4-(pyridin-2-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione (PubChem CID 9312120) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is (4R)-2-(3,4-dimethylphenyl)-4-(pyridin-2-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione.
| Compound Name | (4R)-2-(3,4-dimethylphenyl)-4-(pyridin-2-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 9312120 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (4R)-2-(3,4-dimethylphenyl)-4-(pyridin-2-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3ccccc3[C@H](/C=N/Cc3ccccn3)C2=O)cc1C |
| InChI | InChI=1S/C24H21N3O2/c1-16-10-11-19(13-17(16)2)27-23(28)21-9-4-3-8-20(21)22(24(27)29)15-25-14-18-7-5-6-12-26-18/h3-13,15,22H,14H2,1-2H3/b25-15+/t22-/m0/s1 |
| InChIKey | OFBHRJRUQBMVQR-IBUSPFOHSA-N |
| XLogP | 4.24 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|