C17H12F3N3O2 — CID 9312556
(4S)-2-pyridin-2-yl-4-(2,2,2-trifluoroethyliminomethyl)-4H-isoquinoline-1,3-dione (PubChem CID 9312556) has the molecular formula C17H12F3N3O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is (4S)-2-pyridin-2-yl-4-(2,2,2-trifluoroethyliminomethyl)-4H-isoquinoline-1,3-dione.
| Compound Name | (4S)-2-pyridin-2-yl-4-(2,2,2-trifluoroethyliminomethyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 9312556 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (4S)-2-pyridin-2-yl-4-(2,2,2-trifluoroethyliminomethyl)-4H-isoquinoline-1,3-dione |
| SMILES | O=C1c2ccccc2[C@@H](/C=N/CC(F)(F)F)C(=O)N1c1ccccn1 |
| InChI | InChI=1S/C17H12F3N3O2/c18-17(19,20)10-21-9-13-11-5-1-2-6-12(11)15(24)23(16(13)25)14-7-3-4-8-22-14/h1-9,13H,10H2/b21-9+/t13-/m1/s1 |
| InChIKey | BEFWBTWBDWOMPW-FCQRQVBFSA-N |
| XLogP | 2.99 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|