C22H23N3O4 — CID 9312398
methyl 6-[(1,3-dioxo-2-pyridin-2-yl-4H-isoquinolin-4-yl)methylideneamino]hexanoate (PubChem CID 9312398) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is methyl 6-[(1,3-dioxo-2-pyridin-2-yl-4H-isoquinolin-4-yl)methylideneamino]hexanoate.
| Compound Name | methyl 6-[(1,3-dioxo-2-pyridin-2-yl-4H-isoquinolin-4-yl)methylideneamino]hexanoate |
|---|---|
| PubChem CID | 9312398 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | methyl 6-[(1,3-dioxo-2-pyridin-2-yl-4H-isoquinolin-4-yl)methylideneamino]hexanoate |
| SMILES | COC(=O)CCCCC/N=C/C1C(=O)N(c2ccccn2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H23N3O4/c1-29-20(26)12-3-2-7-13-23-15-18-16-9-4-5-10-17(16)21(27)25(22(18)28)19-11-6-8-14-24-19/h4-6,8-11,14-15,18H,2-3,7,12-13H2,1H3/b23-15+ |
| InChIKey | YXWDJBBGJIWSBE-HZHRSRAPSA-N |
| XLogP | 3.16 |
| TPSA | 88.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|