C23H24N2O5 — CID 9312226
methyl 4-[[(4S)-2-(4-ethoxyphenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]butanoate (PubChem CID 9312226) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is methyl 4-[[(4S)-2-(4-ethoxyphenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]butanoate.
| Compound Name | methyl 4-[[(4S)-2-(4-ethoxyphenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]butanoate |
|---|---|
| PubChem CID | 9312226 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | methyl 4-[[(4S)-2-(4-ethoxyphenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]butanoate |
| SMILES | CCOc1ccc(N2C(=O)c3ccccc3[C@@H](/C=N/CCCC(=O)OC)C2=O)cc1 |
| InChI | InChI=1S/C23H24N2O5/c1-3-30-17-12-10-16(11-13-17)25-22(27)19-8-5-4-7-18(19)20(23(25)28)15-24-14-6-9-21(26)29-2/h4-5,7-8,10-13,15,20H,3,6,9,14H2,1-2H3/b24-15+/t20-/m1/s1 |
| InChIKey | MUKFJFRPVPWLNX-FBTHGLLTSA-N |
| XLogP | 3.38 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|