C24H28N3O3+ — CID 7057842
4-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyliminomethyl]-2-(4-methoxyphenyl)-4H-isoquinoline-1,3-dione (PubChem CID 7057842) has the molecular formula C24H28N3O3+ and a molecular weight of 406.51 g/mol. Its IUPAC name is 4-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyliminomethyl]-2-(4-methoxyphenyl)-4H-isoquinoline-1,3-dione.
| Compound Name | 4-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyliminomethyl]-2-(4-methoxyphenyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7057842 |
| Molecular Formula | C24H28N3O3+ |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 4-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyliminomethyl]-2-(4-methoxyphenyl)-4H-isoquinoline-1,3-dione |
| SMILES | CC[NH+]1CCC[C@H]1C/N=C/C1C(=O)N(c2ccc(OC)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H27N3O3/c1-3-26-14-6-7-18(26)15-25-16-22-20-8-4-5-9-21(20)23(28)27(24(22)29)17-10-12-19(30-2)13-11-17/h4-5,8-13,16,18,22H,3,6-7,14-15H2,1-2H3/p+1/b25-16+/t18-,22?/m0/s1 |
| InChIKey | VFSPHMWIESJKDB-WBQHAKRTSA-O |
| XLogP | 2.10 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|