C21H20N2O5S — CID 7640336
(4R)-4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-2-(4-methoxyphenyl)-4H-isoquinoline-1,3-dione (PubChem CID 7640336) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is (4R)-4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-2-(4-methoxyphenyl)-4H-isoquinoline-1,3-dione.
| Compound Name | (4R)-4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-2-(4-methoxyphenyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7640336 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (4R)-4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-2-(4-methoxyphenyl)-4H-isoquinoline-1,3-dione |
| SMILES | COc1ccc(N2C(=O)c3ccccc3[C@H](/C=N/[C@@H]3CCS(=O)(=O)C3)C2=O)cc1 |
| InChI | InChI=1S/C21H20N2O5S/c1-28-16-8-6-15(7-9-16)23-20(24)18-5-3-2-4-17(18)19(21(23)25)12-22-14-10-11-29(26,27)13-14/h2-9,12,14,19H,10-11,13H2,1H3/b22-12+/t14-,19+/m1/s1 |
| InChIKey | KRUUDUIZLOMZKJ-KNXCTVGOSA-N |
| XLogP | 2.22 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|