C20H17FN2O4S — CID 7640296
(4S)-4-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-2-(4-fluorophenyl)-4H-isoquinoline-1,3-dione (PubChem CID 7640296) has the molecular formula C20H17FN2O4S and a molecular weight of 400.43 g/mol. Its IUPAC name is (4S)-4-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-2-(4-fluorophenyl)-4H-isoquinoline-1,3-dione.
| Compound Name | (4S)-4-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-2-(4-fluorophenyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7640296 |
| Molecular Formula | C20H17FN2O4S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | (4S)-4-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-2-(4-fluorophenyl)-4H-isoquinoline-1,3-dione |
| SMILES | O=C1c2ccccc2[C@@H](/C=N/[C@H]2CCS(=O)(=O)C2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17FN2O4S/c21-13-5-7-15(8-6-13)23-19(24)17-4-2-1-3-16(17)18(20(23)25)11-22-14-9-10-28(26,27)12-14/h1-8,11,14,18H,9-10,12H2/b22-11+/t14-,18+/m0/s1 |
| InChIKey | KVFZWEXLBRVUAN-YDEQVYEWSA-N |
| XLogP | 2.35 |
| TPSA | 83.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|