C11H13NO3S — CID 5150731
2-[(1,1-dioxothiolan-3-yl)iminomethyl]phenol (PubChem CID 5150731) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)iminomethyl]phenol.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 5150731 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)iminomethyl]phenol |
| SMILES | O=S1(=O)CCC(/N=C/c2ccccc2O)C1 |
| InChI | InChI=1S/C11H13NO3S/c13-11-4-2-1-3-9(11)7-12-10-5-6-16(14,15)8-10/h1-4,7,10,13H,5-6,8H2/b12-7+ |
| InChIKey | JCLXEPLCKVWNLU-KPKJPENVSA-N |
| XLogP | 1.00 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|