C6H11NO2S — CID 92852112
N-[(3S)-1,1-dioxothiolan-3-yl]ethanimine (PubChem CID 92852112) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]ethanimine.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]ethanimine |
|---|---|
| PubChem CID | 92852112 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]ethanimine |
| SMILES | C/C=N/[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H11NO2S/c1-2-7-6-3-4-10(8,9)5-6/h2,6H,3-5H2,1H3/b7-2+/t6-/m0/s1 |
| InChIKey | IFRVUPZRIHCGFU-OPRXANKNSA-N |
| XLogP | 0.26 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|