C19H21Cl2NO4S — CID 27340006
cis-[4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]phenyl] (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 27340006) has the molecular formula C19H21Cl2NO4S and a molecular weight of 430.35 g/mol. Its IUPAC name is cis-[4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]phenyl] (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-[4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]phenyl] (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 27340006 |
| Molecular Formula | C19H21Cl2NO4S |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | cis-[4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]phenyl] (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(=O)Oc1ccc(/C=N/[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C19H21Cl2NO4S/c1-19(2)15(9-16(20)21)17(19)18(23)26-14-5-3-12(4-6-14)10-22-13-7-8-27(24,25)11-13/h3-6,9-10,13,15,17H,7-8,11H2,1-2H3/b22-10+/t13-,15+,17-/m1/s1 |
| InChIKey | QMIVXKYJEOARBF-FKRAUWCASA-N |
| XLogP | 3.79 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|