C20H16ClNO4S2 — CID 34257854
[4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 34257854) has the molecular formula C20H16ClNO4S2 and a molecular weight of 433.94 g/mol. Its IUPAC name is [4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 34257854 |
| Molecular Formula | C20H16ClNO4S2 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | [4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(Oc1ccc(/C=N/[C@@H]2CCS(=O)(=O)C2)cc1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C20H16ClNO4S2/c21-18-16-3-1-2-4-17(16)27-19(18)20(23)26-15-7-5-13(6-8-15)11-22-14-9-10-28(24,25)12-14/h1-8,11,14H,9-10,12H2/b22-11+/t14-/m1/s1 |
| InChIKey | OEDHUNOCTSPFGS-DACUGSJHSA-N |
| XLogP | 4.38 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|