C12H15NO4S — CID 135787711
2-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-4-methoxyphenol (PubChem CID 135787711) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-4-methoxyphenol.
| Compound Name | 2-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 135787711 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(/C=N/[C@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C12H15NO4S/c1-17-11-2-3-12(14)9(6-11)7-13-10-4-5-18(15,16)8-10/h2-3,6-7,10,14H,4-5,8H2,1H3/b13-7+/t10-/m0/s1 |
| InChIKey | APRLMDZIEAMMHA-JLATVTFTSA-N |
| XLogP | 1.01 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|