C13H19NO4S — CID 82981858
2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-methoxyphenol (PubChem CID 82981858) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-methoxyphenol.
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 82981858 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(CN(C)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H19NO4S/c1-14(11-5-6-19(16,17)9-11)8-10-7-12(18-2)3-4-13(10)15/h3-4,7,11,15H,5-6,8-9H2,1-2H3 |
| InChIKey | MLAYHZZUZAZNBU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|