C14H19NO4S — CID 62017766
3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-methoxybenzaldehyde (PubChem CID 62017766) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-methoxybenzaldehyde.
| Compound Name | 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 62017766 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1CN(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19NO4S/c1-15(13-5-6-20(17,18)10-13)8-12-7-11(9-16)3-4-14(12)19-2/h3-4,7,9,13H,5-6,8,10H2,1-2H3 |
| InChIKey | LIOJGBBEIGZWDP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|