C16H22N2O6S — CID 7669313
2-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]oxy-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylacetamide (PubChem CID 7669313) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]oxy-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylacetamide.
| Compound Name | 2-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]oxy-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 7669313 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]oxy-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylacetamide |
| SMILES | COc1ccc(/C=N\OCC(=O)N(C)[C@@H]2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C16H22N2O6S/c1-18(13-6-7-25(20,21)11-13)16(19)10-24-17-9-12-4-5-14(22-2)15(8-12)23-3/h4-5,8-9,13H,6-7,10-11H2,1-3H3/b17-9-/t13-/m1/s1 |
| InChIKey | DJLKIBHGUAEACC-ZLYHGVDXSA-N |
| XLogP | 0.70 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|