C17H21NO4S — CID 51322615
1-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-7-methoxynaphthalen-2-ol (PubChem CID 51322615) has the molecular formula C17H21NO4S and a molecular weight of 335.42 g/mol. Its IUPAC name is 1-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-7-methoxynaphthalen-2-ol.
| Compound Name | 1-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-7-methoxynaphthalen-2-ol |
|---|---|
| PubChem CID | 51322615 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-7-methoxynaphthalen-2-ol |
| SMILES | COc1ccc2ccc(O)c(CN(C)C3CCS(=O)(=O)C3)c2c1 |
| InChI | InChI=1S/C17H21NO4S/c1-18(13-7-8-23(20,21)11-13)10-16-15-9-14(22-2)5-3-12(15)4-6-17(16)19/h3-6,9,13,19H,7-8,10-11H2,1-2H3 |
| InChIKey | CBWKGCFSLJKFMV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|