C14H21NO4S — CID 82982632
4-[1-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]-2-methoxyphenol (PubChem CID 82982632) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is 4-[1-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]-2-methoxyphenol.
| Compound Name | 4-[1-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 82982632 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-[1-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]-2-methoxyphenol |
| SMILES | COc1cc(C(C)N(C)C2CCS(=O)(=O)C2)ccc1O |
| InChI | InChI=1S/C14H21NO4S/c1-10(11-4-5-13(16)14(8-11)19-3)15(2)12-6-7-20(17,18)9-12/h4-5,8,10,12,16H,6-7,9H2,1-3H3 |
| InChIKey | PJKYCTLBCFGABU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |