C17H25NO4S — CID 110762934
N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-methoxy-4-propan-2-ylbenzamide (PubChem CID 110762934) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-methoxy-4-propan-2-ylbenzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-methoxy-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 110762934 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-methoxy-4-propan-2-ylbenzamide |
| SMILES | CCN(C(=O)c1ccc(C(C)C)cc1OC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H25NO4S/c1-5-18(14-8-9-23(20,21)11-14)17(19)15-7-6-13(12(2)3)10-16(15)22-4/h6-7,10,12,14H,5,8-9,11H2,1-4H3 |
| InChIKey | NVAPGMSFCPZELY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |