C16H22FNO3S — CID 110316535
N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(4-fluorophenyl)butanamide (PubChem CID 110316535) has the molecular formula C16H22FNO3S and a molecular weight of 327.42 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(4-fluorophenyl)butanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(4-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 110316535 |
| Molecular Formula | C16H22FNO3S |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(4-fluorophenyl)butanamide |
| SMILES | CCN(C(=O)CC(C)c1ccc(F)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22FNO3S/c1-3-18(15-8-9-22(20,21)11-15)16(19)10-12(2)13-4-6-14(17)7-5-13/h4-7,12,15H,3,8-11H2,1-2H3 |
| InChIKey | NQKILVFVGVHBHW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |