C20H30FNO3S — CID 110355785
N-(1,1-dioxothiolan-3-yl)-N,4-diethyl-3-(4-fluorophenyl)hexanamide (PubChem CID 110355785) has the molecular formula C20H30FNO3S and a molecular weight of 383.53 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N,4-diethyl-3-(4-fluorophenyl)hexanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N,4-diethyl-3-(4-fluorophenyl)hexanamide |
|---|---|
| PubChem CID | 110355785 |
| Molecular Formula | C20H30FNO3S |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N,4-diethyl-3-(4-fluorophenyl)hexanamide |
| SMILES | CCC(CC)C(CC(=O)N(CC)C1CCS(=O)(=O)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H30FNO3S/c1-4-15(5-2)19(16-7-9-17(21)10-8-16)13-20(23)22(6-3)18-11-12-26(24,25)14-18/h7-10,15,18-19H,4-6,11-14H2,1-3H3 |
| InChIKey | VACWFZWFIULEBE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |