C14H20N2O2 — CID 135750215
2-[[(1S,2S)-2-aminocyclohexyl]iminomethyl]-4-methoxyphenol (PubChem CID 135750215) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-aminocyclohexyl]iminomethyl]-4-methoxyphenol.
| Compound Name | 2-[[(1S,2S)-2-aminocyclohexyl]iminomethyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 135750215 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-[[(1S,2S)-2-aminocyclohexyl]iminomethyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(/C=N/[C@H]2CCCC[C@@H]2N)c1 |
| InChI | InChI=1S/C14H20N2O2/c1-18-11-6-7-14(17)10(8-11)9-16-13-5-3-2-4-12(13)15/h6-9,12-13,17H,2-5,15H2,1H3/b16-9+/t12-,13-/m0/s1 |
| InChIKey | JNKXNPQFZGGZTD-CSBKXELUSA-N |
| XLogP | 2.09 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|