C24H31CuN2O4+2 — CID 142829958
copper(1+);(2,5-dimethoxyphenyl)methylidene-[2-[(2-hydroxy-5-methoxyphenyl)methylideneamino]cyclohexyl]-methylazanium (PubChem CID 142829958) has the molecular formula C24H31CuN2O4+2 and a molecular weight of 475.07 g/mol. Its IUPAC name is copper(1+);(2,5-dimethoxyphenyl)methylidene-[2-[(2-hydroxy-5-methoxyphenyl)methylideneamino]cyclohexyl]-methylazanium.
| Compound Name | copper(1+);(2,5-dimethoxyphenyl)methylidene-[2-[(2-hydroxy-5-methoxyphenyl)methylideneamino]cyclohexyl]-methylazanium |
|---|---|
| PubChem CID | 142829958 |
| Molecular Formula | C24H31CuN2O4+2 |
| Molecular Weight | 475.07 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | copper(1+);(2,5-dimethoxyphenyl)methylidene-[2-[(2-hydroxy-5-methoxyphenyl)methylideneamino]cyclohexyl]-methylazanium |
| SMILES | COc1ccc(O)c(/C=N/C2CCCCC2/[N+](C)=C/c2cc(OC)ccc2OC)c1.[Cu+] |
| InChI | InChI=1S/C24H30N2O4.Cu/c1-26(16-18-14-20(29-3)10-12-24(18)30-4)22-8-6-5-7-21(22)25-15-17-13-19(28-2)9-11-23(17)27;/h9-16,21-22H,5-8H2,1-4H3;/q;+1/p+1/b26-16+; |
| InChIKey | SEHDLAXFHFMSHM-SAVLHYOGSA-O |
| XLogP | 3.91 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.07 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|