C11H12ClNO3S — CID 135787709
4-chloro-2-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]phenol (PubChem CID 135787709) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is 4-chloro-2-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]phenol.
| Compound Name | 4-chloro-2-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135787709 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 4-chloro-2-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]phenol |
| SMILES | O=S1(=O)CC[C@H](/N=C/c2cc(Cl)ccc2O)C1 |
| InChI | InChI=1S/C11H12ClNO3S/c12-9-1-2-11(14)8(5-9)6-13-10-3-4-17(15,16)7-10/h1-2,5-6,10,14H,3-4,7H2/b13-6+/t10-/m0/s1 |
| InChIKey | LWYCQAMFKYRBPO-FYTLYHSASA-N |
| XLogP | 1.65 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|