C15H14ClNO3S — CID 34306091
1-[5-(3-chlorophenyl)furan-2-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]methanimine (PubChem CID 34306091) has the molecular formula C15H14ClNO3S and a molecular weight of 323.80 g/mol. Its IUPAC name is 1-[5-(3-chlorophenyl)furan-2-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]methanimine.
| Compound Name | 1-[5-(3-chlorophenyl)furan-2-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]methanimine |
|---|---|
| PubChem CID | 34306091 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-[5-(3-chlorophenyl)furan-2-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]methanimine |
| SMILES | O=S1(=O)CC[C@@H](/N=C/c2ccc(-c3cccc(Cl)c3)o2)C1 |
| InChI | InChI=1S/C15H14ClNO3S/c16-12-3-1-2-11(8-12)15-5-4-14(20-15)9-17-13-6-7-21(18,19)10-13/h1-5,8-9,13H,6-7,10H2/b17-9+/t13-/m1/s1 |
| InChIKey | YEYKLPKISFDOQT-LFMVTYOGSA-N |
| XLogP | 3.21 |
| TPSA | 59.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|