C22H23N3O3S — CID 1388078
N-[(3R)-1,1-dioxothiolan-3-yl]-1-[3-(4-ethoxyphenyl)-1-phenylpyrazol-4-yl]methanimine (PubChem CID 1388078) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-1-[3-(4-ethoxyphenyl)-1-phenylpyrazol-4-yl]methanimine.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-1-[3-(4-ethoxyphenyl)-1-phenylpyrazol-4-yl]methanimine |
|---|---|
| PubChem CID | 1388078 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-1-[3-(4-ethoxyphenyl)-1-phenylpyrazol-4-yl]methanimine |
| SMILES | CCOc1ccc(-c2nn(-c3ccccc3)cc2/C=N/[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-2-28-21-10-8-17(9-11-21)22-18(14-23-19-12-13-29(26,27)16-19)15-25(24-22)20-6-4-3-5-7-20/h3-11,14-15,19H,2,12-13,16H2,1H3/b23-14+/t19-/m1/s1 |
| InChIKey | MFXALGJYJABKLC-IXOWOOARSA-N |
| XLogP | 3.54 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|