C20H18IN3O2S — CID 34257593
N-[(3R)-1,1-dioxothiolan-3-yl]-1-[3-(4-iodophenyl)-1-phenylpyrazol-4-yl]methanimine (PubChem CID 34257593) has the molecular formula C20H18IN3O2S and a molecular weight of 491.35 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-1-[3-(4-iodophenyl)-1-phenylpyrazol-4-yl]methanimine.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-1-[3-(4-iodophenyl)-1-phenylpyrazol-4-yl]methanimine |
|---|---|
| PubChem CID | 34257593 |
| Molecular Formula | C20H18IN3O2S |
| Molecular Weight | 491.35 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-1-[3-(4-iodophenyl)-1-phenylpyrazol-4-yl]methanimine |
| SMILES | O=S1(=O)CC[C@@H](/N=C/c2cn(-c3ccccc3)nc2-c2ccc(I)cc2)C1 |
| InChI | InChI=1S/C20H18IN3O2S/c21-17-8-6-15(7-9-17)20-16(12-22-18-10-11-27(25,26)14-18)13-24(23-20)19-4-2-1-3-5-19/h1-9,12-13,18H,10-11,14H2/b22-12+/t18-/m1/s1 |
| InChIKey | SWVYDZNPTNZZNR-FNLSEGDXSA-N |
| XLogP | 3.75 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|