C32H24N4O4S — CID 19131454
(5Z)-1-(1,1-dioxothiolan-3-yl)-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-2,6-dioxo-4-phenylpyridine-3-carbonitrile (PubChem CID 19131454) has the molecular formula C32H24N4O4S and a molecular weight of 560.64 g/mol. Its IUPAC name is (5Z)-1-(1,1-dioxothiolan-3-yl)-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-2,6-dioxo-4-phenylpyridine-3-carbonitrile.
| Compound Name | (5Z)-1-(1,1-dioxothiolan-3-yl)-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-2,6-dioxo-4-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19131454 |
| Molecular Formula | C32H24N4O4S |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | (5Z)-1-(1,1-dioxothiolan-3-yl)-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-2,6-dioxo-4-phenylpyridine-3-carbonitrile |
| SMILES | N#CC1=C(c2ccccc2)/C(=C/c2cn(-c3ccccc3)nc2-c2ccccc2)C(=O)N(C2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C32H24N4O4S/c33-19-28-29(22-10-4-1-5-11-22)27(31(37)36(32(28)38)26-16-17-41(39,40)21-26)18-24-20-35(25-14-8-3-9-15-25)34-30(24)23-12-6-2-7-13-23/h1-15,18,20,26H,16-17,21H2/b27-18- |
| InChIKey | QNBJRNMRULCNKW-IMRQLAEWSA-N |
| XLogP | 4.46 |
| TPSA | 113.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|