C25H20N4O5S — CID 3717763
1-(1,1-dioxothiolan-3-yl)-5-[[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 3717763) has the molecular formula C25H20N4O5S and a molecular weight of 488.53 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-5-[[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-5-[[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3717763 |
| Molecular Formula | C25H20N4O5S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-5-[[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(C2CCS(=O)(=O)C2)C(=O)C1=Cc1cn(-c2ccccc2)nc1-c1ccco1 |
| InChI | InChI=1S/C25H20N4O5S/c1-16-20(24(30)29(25(31)21(16)13-26)19-9-11-35(32,33)15-19)12-17-14-28(18-6-3-2-4-7-18)27-23(17)22-8-5-10-34-22/h2-8,10,12,14,19H,9,11,15H2,1H3 |
| InChIKey | ZSOVEVAHCQZQBJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 126.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|