C31H30N4O2S — CID 19112332
(5E)-1-cyclohexyl-5-[[3-(4-ethylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19112332) has the molecular formula C31H30N4O2S and a molecular weight of 522.67 g/mol. Its IUPAC name is (5E)-1-cyclohexyl-5-[[3-(4-ethylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-cyclohexyl-5-[[3-(4-ethylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112332 |
| Molecular Formula | C31H30N4O2S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | (5E)-1-cyclohexyl-5-[[3-(4-ethylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCSc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(C3CCCCC3)C(=O)C(C#N)=C2C)cc1 |
| InChI | InChI=1S/C31H30N4O2S/c1-3-38-26-16-14-22(15-17-26)29-23(20-34(33-29)24-10-6-4-7-11-24)18-27-21(2)28(19-32)31(37)35(30(27)36)25-12-8-5-9-13-25/h4,6-7,10-11,14-18,20,25H,3,5,8-9,12-13H2,1-2H3/b27-18+ |
| InChIKey | PIHYAZIHNAWPQO-OVVQPSECSA-N |
| XLogP | 6.58 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|