C37H34N4O5S2 — CID 19131582
(5Z)-5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-4-(4-methoxyphenyl)-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19131582) has the molecular formula C37H34N4O5S2 and a molecular weight of 678.84 g/mol. Its IUPAC name is (5Z)-5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-4-(4-methoxyphenyl)-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-4-(4-methoxyphenyl)-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19131582 |
| Molecular Formula | C37H34N4O5S2 |
| Molecular Weight | 678.84 g/mol |
| Exact Mass | 678.20 |
| IUPAC Name | (5Z)-5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-4-(4-methoxyphenyl)-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCCSc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\C(=O)N(C3CCS(=O)(=O)C3)C(=O)C(C#N)=C2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H34N4O5S2/c1-3-4-19-47-31-16-12-26(13-17-31)35-27(23-40(39-35)28-8-6-5-7-9-28)21-32-34(25-10-14-30(46-2)15-11-25)33(22-38)37(43)41(36(32)42)29-18-20-48(44,45)24-29/h5-17,21,23,29H,3-4,18-20,24H2,1-2H3/b32-21- |
| InChIKey | BQTDGJXBQSKGDF-QXPFVDMISA-N |
| XLogP | 6.36 |
| TPSA | 122.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.84 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|