C36H31ClN4O6S — CID 19131591
(5Z)-5-[[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-4-(4-methoxyphenyl)-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19131591) has the molecular formula C36H31ClN4O6S and a molecular weight of 683.19 g/mol. Its IUPAC name is (5Z)-5-[[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-4-(4-methoxyphenyl)-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-5-[[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-4-(4-methoxyphenyl)-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19131591 |
| Molecular Formula | C36H31ClN4O6S |
| Molecular Weight | 683.19 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | (5Z)-5-[[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-4-(4-methoxyphenyl)-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\C(=O)N(C3CCS(=O)(=O)C3)C(=O)C(C#N)=C2c2ccc(OC)cc2)cc1Cl |
| InChI | InChI=1S/C36H31ClN4O6S/c1-3-16-47-32-14-11-24(19-31(32)37)34-25(21-40(39-34)26-7-5-4-6-8-26)18-29-33(23-9-12-28(46-2)13-10-23)30(20-38)36(43)41(35(29)42)27-15-17-48(44,45)22-27/h4-14,18-19,21,27H,3,15-17,22H2,1-2H3/b29-18- |
| InChIKey | QWXQRYMIEBOFDQ-MIXAMLLLSA-N |
| XLogP | 5.91 |
| TPSA | 131.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.19 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|